CAS 2093388-52-2 appears in our catalog under these names: Thalidomide–NH–C4–NH–Boc, Thalidomide-NH-C4-NH-Boc/ 98.87% (existing batch purity), tert-butyl (4-((2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)amino)butyl)carbamate, 98%, 98%, Thalidomide-NH-C4-NH-Boc, 99.64%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 100mg, 25mg, 5mg, 50mg, 500mg, 50 mg.
Tert-butyl N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]carbamate (CAS 2093388-52-2) is a chemical compound with the molecular formula C22H28N4O6 and a molecular weight of 444.5 g/mol. IUPAC name: tert-butyl N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]carbamate. InChIKey: OYPNLZMEXLFKLB-UHFFFAOYSA-N.
| Molecular formula | C22H28N4O6 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | tert-butyl N-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butyl]carbamate |
| InChIKey | OYPNLZMEXLFKLB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCNC1=CC=CC2=C1C(=O)N(C2=O)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)