CAS 2093389-34-3 is the registry number for 1,7-Dimethyl-8-(methylsulfonyl)-3,7-dihydro-1H-purine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,7-dimethyl-8-methylsulfonyl-3H-purine-2,6-dione (CAS 2093389-34-3) is a chemical compound with the molecular formula C8H10N4O4S and a molecular weight of 258.26 g/mol. IUPAC name: 1,7-dimethyl-8-methylsulfonyl-3H-purine-2,6-dione. InChIKey: CTMMAPGNTHADKA-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O4S |
|---|---|
| Molecular weight | 258.26 g/mol |
| IUPAC name | 1,7-dimethyl-8-methylsulfonyl-3H-purine-2,6-dione |
| InChIKey | CTMMAPGNTHADKA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(NC(=O)N(C2=O)C)N=C1S(=O)(=O)C |
Computed by PubChem (NCBI)