CAS 2093422-14-9 is the registry number for 5-Methyl-1-(4-oxo-3,4-dihydropyrrolo[2,1-f][1,2,4]triazin-2-yl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-1-(4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl)pyrazole-4-carboxylic acid (CAS 2093422-14-9) is a chemical compound with the molecular formula C11H9N5O3 and a molecular weight of 259.22 g/mol. IUPAC name: 5-methyl-1-(4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl)pyrazole-4-carboxylic acid. InChIKey: FLDHKWRHJZFDMY-UHFFFAOYSA-N.
| Molecular formula | C11H9N5O3 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 5-methyl-1-(4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-2-yl)pyrazole-4-carboxylic acid |
| InChIKey | FLDHKWRHJZFDMY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=NN3C=CC=C3C(=O)N2)C(=O)O |
Computed by PubChem (NCBI)