CAS 1338661-82-7 is the registry number for [7-(3-Methyl-1,2,4-oxadiazol-5-yl)[1,2,4]triazolo[4,3-a]pyridin-3-yl]acetic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[7-(3-methyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]acetic acid (CAS 1338661-82-7) is a chemical compound with the molecular formula C11H9N5O3 and a molecular weight of 259.22 g/mol. IUPAC name: 2-[7-(3-methyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]acetic acid. InChIKey: KGRIFBGKVJCIGY-UHFFFAOYSA-N.
| Molecular formula | C11H9N5O3 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 2-[7-(3-methyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]acetic acid |
| InChIKey | KGRIFBGKVJCIGY-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=CC3=NN=C(N3C=C2)CC(=O)O |
Computed by PubChem (NCBI)