Products 2093458-71-8
CAS 2093458-71-8 is the registry number for 2-Amino-6-chloro-4-methyl-3-pyridinecarboxamide, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-amino-6-chloro-4-methylpyridine-3-carboxamide (CAS 2093458-71-8) is a chemical compound with the molecular formula C7H8ClN3O and a molecular weight of 185.61 g/mol. IUPAC name: 2-amino-6-chloro-4-methylpyridine-3-carboxamide. InChIKey: YPFSAWFQVROHGL-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-amino-6-chloro-4-methylpyridine-3-carboxamide |
| InChIKey | YPFSAWFQVROHGL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(=O)N)N)Cl |
Computed by PubChem (NCBI)