Products 2093536-13-9
CAS 2093536-13-9 appears in our catalog under these names: Thalidomide–NH–C6–NH–Boc, Thalidomide-NH-C6-NH-Boc 98%, Thalidomide-NH-C6-NH-Boc, 98%, 98%, Thalidomide-NH-C6-NH-Boc, 96.11%, Thalidomide-NH-C6-NH-Boc, 96%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 50mg, 250mg, 1g, 250 mg, 100 mg.
Tert-butyl N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexyl]carbamate (CAS 2093536-13-9) is a chemical compound with the molecular formula C24H32N4O6 and a molecular weight of 472.5 g/mol. IUPAC name: tert-butyl N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexyl]carbamate. InChIKey: MYIJXYLTQWCASN-UHFFFAOYSA-N.
| Molecular formula | C24H32N4O6 |
|---|---|
| Molecular weight | 472.5 g/mol |
| IUPAC name | tert-butyl N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexyl]carbamate |
| InChIKey | MYIJXYLTQWCASN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNC1=CC=CC2=C1C(=O)N(C2=O)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)