CAS 2093978-90-4 is the registry number for 4,6-dichloro-3-cyclobutyl-1-(4-fluorophenyl)-1H-pyrazolo[3,4-b]pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,6-dichloro-3-cyclobutyl-1-(4-fluorophenyl)pyrazolo[5,4-b]pyridine (CAS 2093978-90-4) is a chemical compound with the molecular formula C16H12Cl2FN3 and a molecular weight of 336.2 g/mol. IUPAC name: 4,6-dichloro-3-cyclobutyl-1-(4-fluorophenyl)pyrazolo[5,4-b]pyridine. InChIKey: DMHDUWLHQRFZRO-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2FN3 |
|---|---|
| Molecular weight | 336.2 g/mol |
| IUPAC name | 4,6-dichloro-3-cyclobutyl-1-(4-fluorophenyl)pyrazolo[5,4-b]pyridine |
| InChIKey | DMHDUWLHQRFZRO-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=NN(C3=C2C(=CC(=N3)Cl)Cl)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)