Products 2094130-11-5
CAS 2094130-11-5 is the registry number for 2-Amino-N-methanesulfonylpent-4-ynamide hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-N-methylsulfonylpent-4-ynamide;hydrochloride (CAS 2094130-11-5) is a chemical compound with the molecular formula C6H11ClN2O3S and a molecular weight of 226.68 g/mol. IUPAC name: 2-amino-N-methylsulfonylpent-4-ynamide;hydrochloride. InChIKey: YUMVMGLFMYXRPR-UHFFFAOYSA-N.
| Molecular formula | C6H11ClN2O3S |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | 2-amino-N-methylsulfonylpent-4-ynamide;hydrochloride |
| InChIKey | YUMVMGLFMYXRPR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC(=O)C(CC#C)N.Cl |
Computed by PubChem (NCBI)