CAS 2094517-63-0 is the registry number for Potassium 1-[(tert-butoxy)carbonyl]-4-fluoropiperidine-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Potassium 4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylate (CAS 2094517-63-0) is a chemical compound with the molecular formula C11H17FKNO4 and a molecular weight of 285.35 g/mol. IUPAC name: potassium 4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylate. InChIKey: OSKAWMLVHVKKDC-UHFFFAOYSA-M.
| Molecular formula | C11H17FKNO4 |
|---|---|
| Molecular weight | 285.35 g/mol |
| IUPAC name | potassium 4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylate |
| InChIKey | OSKAWMLVHVKKDC-UHFFFAOYSA-M |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C(=O)[O-])F.[K+] |
Computed by PubChem (NCBI)