Products 2094598-61-3
CAS 2094598-61-3 is the registry number for 3-{((2-Chlorophenyl)methyl)((9H-fluoren-9-ylmethoxy)carbonyl)amino}propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-[(2-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid (CAS 2094598-61-3) is a chemical compound with the molecular formula C25H22ClNO4 and a molecular weight of 435.9 g/mol. IUPAC name: 3-[(2-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid. InChIKey: BXNTZNYXWQQVIW-UHFFFAOYSA-N.
| Molecular formula | C25H22ClNO4 |
|---|---|
| Molecular weight | 435.9 g/mol |
| IUPAC name | 3-[(2-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
| InChIKey | BXNTZNYXWQQVIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN(CCC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)Cl |
Computed by PubChem (NCBI)