Products 2095114-72-8
CAS 2095114-72-8 appears in our catalog under these names: Berkeleylactone F, Berkeleylactone F. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 1 mg.
(3Z,5R,6S,15S,16R)-5,6,15-trihydroxy-16-methyl-1-oxacyclohexadec-3-en-2-one (CAS 2095114-72-8) is a chemical compound with the molecular formula C16H28O5 and a molecular weight of 300.39 g/mol. IUPAC name: (3Z,5R,6S,15S,16R)-5,6,15-trihydroxy-16-methyl-1-oxacyclohexadec-3-en-2-one. InChIKey: OXTXYWGSTRVDDS-JQVBQBHMSA-N.
| Molecular formula | C16H28O5 |
|---|---|
| Molecular weight | 300.39 g/mol |
| IUPAC name | (3Z,5R,6S,15S,16R)-5,6,15-trihydroxy-16-methyl-1-oxacyclohexadec-3-en-2-one |
| InChIKey | OXTXYWGSTRVDDS-JQVBQBHMSA-N |
| SMILES | C[C@@H]1[C@H](CCCCCCCC[C@@H]([C@@H](/C=C\C(=O)O1)O)O)O |
Computed by PubChem (NCBI)