CAS 2095156-13-9 appears in our catalog under these names: HSL-IN-1, 98%, HSL-IN-1/ 97.45% (existing batch purity), HSL-IN-1, HSL-IN-1, 99.65%, HSL-IN-1 (Standard). Offered by: AmBeed, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 2mg, 50mg, 25mg, 5mg, 10mg, 5 mg, 25 mg.
[5-chloro-2-[[6-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonyl]amino]phenyl]boronic acid (CAS 2095156-13-9) is a chemical compound with the molecular formula C19H13BClF3N2O4 and a molecular weight of 436.6 g/mol. IUPAC name: [5-chloro-2-[[6-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonyl]amino]phenyl]boronic acid. InChIKey: PDMXSCCBEBCTGX-UHFFFAOYSA-N.
| Molecular formula | C19H13BClF3N2O4 |
|---|---|
| Molecular weight | 436.6 g/mol |
| IUPAC name | [5-chloro-2-[[6-[4-(trifluoromethyl)phenoxy]pyridine-3-carbonyl]amino]phenyl]boronic acid |
| InChIKey | PDMXSCCBEBCTGX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)NC(=O)C2=CN=C(C=C2)OC3=CC=C(C=C3)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)