CAS 2095165-20-9 is the registry number for [4-(Aminomethyl)-3,5-difluorophenyl]boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[4-(aminomethyl)-3,5-difluorophenyl]boronic acid (CAS 2095165-20-9) is a chemical compound with the molecular formula C7H8BF2NO2 and a molecular weight of 186.95 g/mol. IUPAC name: [4-(aminomethyl)-3,5-difluorophenyl]boronic acid. InChIKey: HZHXJYOKGOZNCH-UHFFFAOYSA-N.
| Molecular formula | C7H8BF2NO2 |
|---|---|
| Molecular weight | 186.95 g/mol |
| IUPAC name | [4-(aminomethyl)-3,5-difluorophenyl]boronic acid |
| InChIKey | HZHXJYOKGOZNCH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)CN)F)(O)O |
Computed by PubChem (NCBI)