Products 2095192-08-6

CAS 2095192-08-6 is the registry number for cis-6-azabicyclo[3.2.0]heptane,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

(1R,5R)-6-azabicyclo[3.2.0]heptane;hydrochloride (CAS 2095192-08-6) is a chemical compound with the molecular formula C6H12ClN and a molecular weight of 133.62 g/mol. IUPAC name: (1R,5R)-6-azabicyclo[3.2.0]heptane;hydrochloride. InChIKey: MMSVVUFBVQDEMD-KGZKBUQUSA-N.

Identity
Molecular formulaC6H12ClN
Molecular weight133.62 g/mol
IUPAC name(1R,5R)-6-azabicyclo[3.2.0]heptane;hydrochloride
InChIKeyMMSVVUFBVQDEMD-KGZKBUQUSA-N
SMILESC1C[C@@H]2CN[C@@H]2C1.Cl

Computed by PubChem (NCBI)