CAS 2095192-16-6 appears in our catalog under these names: Rac-(1r,5r,6r)-2-azabicyclo[3.2.0]heptan-6-ol hydrochloride, 95%, rac-(1R,5R,6R)-2-Azabicyclo(3.2.0)heptan-6-ol hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
(1R,5R,6R)-2-azabicyclo[3.2.0]heptan-6-ol;hydrochloride (CAS 2095192-16-6) is a chemical compound with the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. IUPAC name: (1R,5R,6R)-2-azabicyclo[3.2.0]heptan-6-ol;hydrochloride. InChIKey: MTAGMASLRLYPTF-RWOHWRPJSA-N.
| Molecular formula | C6H12ClNO |
|---|---|
| Molecular weight | 149.62 g/mol |
| IUPAC name | (1R,5R,6R)-2-azabicyclo[3.2.0]heptan-6-ol;hydrochloride |
| InChIKey | MTAGMASLRLYPTF-RWOHWRPJSA-N |
| SMILES | C1CN[C@H]2[C@@H]1[C@@H](C2)O.Cl |
Computed by PubChem (NCBI)