CAS 2095192-21-3 appears in our catalog under these names: Rac-(1r,5s,6r)-3-azabicyclo[3.2.0]heptan-6-ol hydrochloride, 95%, rel-(1R,5S,6R)-3-Azabicyclo(3.2.0)heptan-6-ol hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(1R,5S,6R)-3-azabicyclo[3.2.0]heptan-6-ol;hydrochloride (CAS 2095192-21-3) is a chemical compound with the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. IUPAC name: (1R,5S,6R)-3-azabicyclo[3.2.0]heptan-6-ol;hydrochloride. InChIKey: XMKPHELWJMSDHY-FPKZOZHISA-N.
| Molecular formula | C6H12ClNO |
|---|---|
| Molecular weight | 149.62 g/mol |
| IUPAC name | (1R,5S,6R)-3-azabicyclo[3.2.0]heptan-6-ol;hydrochloride |
| InChIKey | XMKPHELWJMSDHY-FPKZOZHISA-N |
| SMILES | C1[C@H]2CNC[C@H]2[C@@H]1O.Cl |
Computed by PubChem (NCBI)