CAS 2095250-24-9 is the registry number for tert-butyl trans-3-hydroxy-2-methylazetidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl (2R,3S)-3-hydroxy-2-methylazetidine-1-carboxylate (CAS 2095250-24-9) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: tert-butyl (2R,3S)-3-hydroxy-2-methylazetidine-1-carboxylate. InChIKey: OBLFUJCDADLZAJ-RQJHMYQMSA-N.
| Molecular formula | C9H17NO3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | tert-butyl (2R,3S)-3-hydroxy-2-methylazetidine-1-carboxylate |
| InChIKey | OBLFUJCDADLZAJ-RQJHMYQMSA-N |
| SMILES | C[C@@H]1[C@H](CN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)