CAS 2095409-16-6 appears in our catalog under these names: 2-amino-3-(1h-1,2,4-triazol-1-yl)propanoic acid dihydrochloride, 95%, Prothioconazole Impurity 9 DiHCl. Offered by: Combi-blocks, Chemat Brand, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg, on request.
2-amino-3-(1,2,4-triazol-1-yl)propanoic acid;dihydrochloride (CAS 2095409-16-6) is a chemical compound with the molecular formula C5H10Cl2N4O2 and a molecular weight of 229.06 g/mol. IUPAC name: 2-amino-3-(1,2,4-triazol-1-yl)propanoic acid;dihydrochloride. InChIKey: WLYIXRIIIRTKIN-UHFFFAOYSA-N.
| Molecular formula | C5H10Cl2N4O2 |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2-amino-3-(1,2,4-triazol-1-yl)propanoic acid;dihydrochloride |
| InChIKey | WLYIXRIIIRTKIN-UHFFFAOYSA-N |
| SMILES | C1=NN(C=N1)CC(C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)