CAS 2095409-26-8 is the registry number for 6-Chloropyrazine-2-sulfonyl fluoride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloropyrazine-2-sulfonyl fluoride (CAS 2095409-26-8) is a chemical compound with the molecular formula C4H2ClFN2O2S and a molecular weight of 196.59 g/mol. IUPAC name: 6-chloropyrazine-2-sulfonyl fluoride. InChIKey: OVIWMMPJQDHRPN-UHFFFAOYSA-N.
| Molecular formula | C4H2ClFN2O2S |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 6-chloropyrazine-2-sulfonyl fluoride |
| InChIKey | OVIWMMPJQDHRPN-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C=N1)Cl)S(=O)(=O)F |
Computed by PubChem (NCBI)