CAS 2095409-64-4 is the registry number for 6,6,7,7-Tetrafluoro-3-azabicyclo(3.2.0)heptane hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 1g, 250mg.
6,6,7,7-tetrafluoro-3-azabicyclo[3.2.0]heptane;hydrochloride (CAS 2095409-64-4) is a chemical compound with the molecular formula C6H8ClF4N and a molecular weight of 205.58 g/mol. IUPAC name: 6,6,7,7-tetrafluoro-3-azabicyclo[3.2.0]heptane;hydrochloride. InChIKey: MAFPYSAKROXUNR-UHFFFAOYSA-N.
| Molecular formula | C6H8ClF4N |
|---|---|
| Molecular weight | 205.58 g/mol |
| IUPAC name | 6,6,7,7-tetrafluoro-3-azabicyclo[3.2.0]heptane;hydrochloride |
| InChIKey | MAFPYSAKROXUNR-UHFFFAOYSA-N |
| SMILES | C1C2C(CN1)C(C2(F)F)(F)F.Cl |
Computed by PubChem (NCBI)