CAS 2095409-68-8 is the registry number for {spiro(3.3)heptan-2-yl}methanesulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Spiro[3.3]heptan-2-ylmethanesulfonyl chloride (CAS 2095409-68-8) is a chemical compound with the molecular formula C8H13ClO2S and a molecular weight of 208.71 g/mol. IUPAC name: spiro[3.3]heptan-2-ylmethanesulfonyl chloride. InChIKey: ZYSWFYQYACUEPF-UHFFFAOYSA-N.
| Molecular formula | C8H13ClO2S |
|---|---|
| Molecular weight | 208.71 g/mol |
| IUPAC name | spiro[3.3]heptan-2-ylmethanesulfonyl chloride |
| InChIKey | ZYSWFYQYACUEPF-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CC(C2)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)