CAS 2095410-91-4 is the registry number for Ethyl 2-(2-amino-1-methyl-1H-imidazol-5-yl)-3,3,3-trifluoro-2-hydroxypropanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 2-(2-amino-3-methylimidazol-4-yl)-3,3,3-trifluoro-2-hydroxypropanoate (CAS 2095410-91-4) is a chemical compound with the molecular formula C9H12F3N3O3 and a molecular weight of 267.21 g/mol. IUPAC name: ethyl 2-(2-amino-3-methylimidazol-4-yl)-3,3,3-trifluoro-2-hydroxypropanoate. InChIKey: QGEMABTVAXPOBO-UHFFFAOYSA-N.
| Molecular formula | C9H12F3N3O3 |
|---|---|
| Molecular weight | 267.21 g/mol |
| IUPAC name | ethyl 2-(2-amino-3-methylimidazol-4-yl)-3,3,3-trifluoro-2-hydroxypropanoate |
| InChIKey | QGEMABTVAXPOBO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CN=C(N1C)N)(C(F)(F)F)O |
Computed by PubChem (NCBI)