CAS 2095411-14-4 is the registry number for 5-(Trifluoromethyl)pyridine-2-sulfonyl fluoride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-(trifluoromethyl)pyridine-2-sulfonyl fluoride (CAS 2095411-14-4) is a chemical compound with the molecular formula C6H3F4NO2S and a molecular weight of 229.15 g/mol. IUPAC name: 5-(trifluoromethyl)pyridine-2-sulfonyl fluoride. InChIKey: MCJUWZWWFSIMHG-UHFFFAOYSA-N.
| Molecular formula | C6H3F4NO2S |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | 5-(trifluoromethyl)pyridine-2-sulfonyl fluoride |
| InChIKey | MCJUWZWWFSIMHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)S(=O)(=O)F |
Computed by PubChem (NCBI)