Products 2095417-25-5
CAS 2095417-25-5 is the registry number for 6-Methylpurine-β-D-(3-azido-3-deoxy)riboside. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,4S,5S)-4-azido-5-(hydroxymethyl)-2-(6-methylpurin-9-yl)oxolan-3-ol (CAS 2095417-25-5) is a chemical compound with the molecular formula C11H13N7O3 and a molecular weight of 291.27 g/mol. IUPAC name: (2R,3R,4S,5S)-4-azido-5-(hydroxymethyl)-2-(6-methylpurin-9-yl)oxolan-3-ol. InChIKey: HPBJRUZZQUZFRC-PNHWDRBUSA-N.
| Molecular formula | C11H13N7O3 |
|---|---|
| Molecular weight | 291.27 g/mol |
| IUPAC name | (2R,3R,4S,5S)-4-azido-5-(hydroxymethyl)-2-(6-methylpurin-9-yl)oxolan-3-ol |
| InChIKey | HPBJRUZZQUZFRC-PNHWDRBUSA-N |
| SMILES | CC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)N=[N+]=[N-])O |
Computed by PubChem (NCBI)