CAS 2095432-75-8 appears in our catalog under these names: AMBMP Hydrochloride, AMBMP hydrochloride, BML-284 hydrochloride/ 99.79% (existing batch purity), BML-284 HCL, BML-284 (hydrochloride). Offered by: TRC, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 250mg, 10mg, 50mg, 1mg, 5mg, 25mg, 100mg, 200mg.
4-N-(1,3-benzodioxol-5-ylmethyl)-6-(3-methoxyphenyl)pyrimidine-2,4-diamine;hydrochloride (CAS 2095432-75-8) is a chemical compound with the molecular formula C19H19ClN4O3 and a molecular weight of 386.8 g/mol. IUPAC name: 4-N-(1,3-benzodioxol-5-ylmethyl)-6-(3-methoxyphenyl)pyrimidine-2,4-diamine;hydrochloride. InChIKey: XZOFNDFDGVAIEH-UHFFFAOYSA-N.
| Molecular formula | C19H19ClN4O3 |
|---|---|
| Molecular weight | 386.8 g/mol |
| IUPAC name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-(3-methoxyphenyl)pyrimidine-2,4-diamine;hydrochloride |
| InChIKey | XZOFNDFDGVAIEH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=NC(=N2)N)NCC3=CC4=C(C=C3)OCO4.Cl |
Computed by PubChem (NCBI)