Products 2095433-95-5

CAS 2095433-95-5 is the registry number for RJR-2403 hemioxalate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Bis((E)-N-methyl-4-pyridin-3-ylbut-3-en-1-amine);oxalic acid (CAS 2095433-95-5) is a chemical compound with the molecular formula C22H30N4O4 and a molecular weight of 414.5 g/mol. IUPAC name: bis((E)-N-methyl-4-pyridin-3-ylbut-3-en-1-amine);oxalic acid. InChIKey: VWROAWUIKILZJB-ITOWEXLMSA-N.

Identity
Molecular formulaC22H30N4O4
Molecular weight414.5 g/mol
IUPAC namebis((E)-N-methyl-4-pyridin-3-ylbut-3-en-1-amine);oxalic acid
InChIKeyVWROAWUIKILZJB-ITOWEXLMSA-N
SMILESCNCC/C=C/C1=CN=CC=C1.CNCC/C=C/C1=CN=CC=C1.C(=O)(O)C(=O)O

Computed by PubChem (NCBI)