CAS 2095551-89-4 is the registry number for SAS-0132. Offered by: MedChemExpress. Available pack sizes: Get quote.
Benzyl (1S,8R)-5-(4-methylpiperazin-1-yl)-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-9-carboxylate (CAS 2095551-89-4) is a chemical compound with the molecular formula C24H29N3O2 and a molecular weight of 391.5 g/mol. IUPAC name: benzyl (1S,8R)-5-(4-methylpiperazin-1-yl)-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-9-carboxylate. InChIKey: CQQWIHMDQBNBBE-WMZHIEFXSA-N.
| Molecular formula | C24H29N3O2 |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | benzyl (1S,8R)-5-(4-methylpiperazin-1-yl)-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-9-carboxylate |
| InChIKey | CQQWIHMDQBNBBE-WMZHIEFXSA-N |
| SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)[C@H]4CCN([C@@H]3C4)C(=O)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)