CAS 2095625-97-9 appears in our catalog under these names: Milademetan tosylate hydrate, Milademetan tosylate, Milademetan (tosylate hydrate), 98.21%, 98.21%, Milademetan (tosylate hydrate), 98.89%, Milademetan (tosylate hydrate) (Standard). Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 25mg, 5 mg, 10mM/1mL, 100 mg.
CAS 2095625-97-9 identifies a chemical compound with the molecular formula C37H44Cl2FN5O8S and a molecular weight of 808.7 g/mol. InChIKey: WPJOGWGXMTUHPW-CIPNXXNHSA-N.
| Molecular formula | C37H44Cl2FN5O8S |
|---|---|
| Molecular weight | 808.7 g/mol |
| InChIKey | WPJOGWGXMTUHPW-CIPNXXNHSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1(CCC2(CC1)[C@@]3([C@H]([C@@H](N2)C(=O)N[C@@H]4CC[C@H](OC4)C(=O)N)C5=C(C(=NC=C5)Cl)F)C6=C(C=C(C=C6)Cl)NC3=O)C.O |
Computed by PubChem (NCBI)