CAS 2095709-78-5 appears in our catalog under these names: Adenine Hydrochloride-15N5, >95% (HPLC), Adenine hydrochloride-15N5, Adenine-15N5 (hydrochloride), 99.84%. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 2mg, 1 mg, 5 mg.
7H-purin-6-(15N)amine;hydrochloride (CAS 2095709-78-5) is a chemical compound with the molecular formula C5H6ClN5 and a molecular weight of 176.55 g/mol. IUPAC name: 7H-purin-6-(15N)amine;hydrochloride. InChIKey: UQVDQSWZQXDUJB-KBVYELETSA-N.
| Molecular formula | C5H6ClN5 |
|---|---|
| Molecular weight | 176.55 g/mol |
| IUPAC name | 7H-purin-6-(15N)amine;hydrochloride |
| InChIKey | UQVDQSWZQXDUJB-KBVYELETSA-N |
| SMILES | C1=[15N]C2=[15N]C=[15N]C(=C2[15NH]1)[15NH2].Cl |
Computed by PubChem (NCBI)