Products 2095777-38-9
CAS 2095777-38-9 appears in our catalog under these names: Itaconic acid–13C5, Itaconic Acid-13C5, 97%, 97%, Itaconic acid-13C5, 97.00%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 50 μg.
2-(113C)methylidene(1,2,3,4-13C4)butanedioic acid (CAS 2095777-38-9) is a chemical compound with the molecular formula C5H6O4 and a molecular weight of 135.062 g/mol. IUPAC name: 2-(113C)methylidene(1,2,3,4-13C4)butanedioic acid. InChIKey: LVHBHZANLOWSRM-CVMUNTFWSA-N.
| Molecular formula | C5H6O4 |
|---|---|
| Molecular weight | 135.062 g/mol |
| IUPAC name | 2-(113C)methylidene(1,2,3,4-13C4)butanedioic acid |
| InChIKey | LVHBHZANLOWSRM-CVMUNTFWSA-N |
| SMILES | [13CH2]=[13C]([13CH2][13C](=O)O)[13C](=O)O |
Computed by PubChem (NCBI)