CAS 2095786-11-9 is the registry number for Rosuvastatin Impurity 67. Offered by: Chemat Brand. Available pack sizes: on request.
(4S,6R)-2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxane-4-carboxylic acid (CAS 2095786-11-9) is a chemical compound with the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. IUPAC name: (4S,6R)-2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxane-4-carboxylic acid. InChIKey: WPNWCPFDDMGWBC-BDAKNGLRSA-N.
| Molecular formula | C13H22O6 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | (4S,6R)-2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxane-4-carboxylic acid |
| InChIKey | WPNWCPFDDMGWBC-BDAKNGLRSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)C(=O)O)CC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)