CAS 2096-78-8 appears in our catalog under these names: Diphenyl(vinyl)phosphine oxide, 95%, Diphenyl(vinyl)phosphine oxide, 98% mix TBC as stabilizer, Diphenyl(vinyl)phosphine oxide, 98%(stabilized with TBC), 98%(stabilized with TBC), PHOSPHINE OXIDE, ETHENYLDIPHENYL-, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 5mg, 10mg, 100mg, 250mg.
[ethenyl(phenyl)phosphoryl]benzene (CAS 2096-78-8) is a chemical compound with the molecular formula C14H13OP and a molecular weight of 228.23 g/mol. IUPAC name: [ethenyl(phenyl)phosphoryl]benzene. InChIKey: CQCGPNRIAFVNBY-UHFFFAOYSA-N.
| Molecular formula | C14H13OP |
|---|---|
| Molecular weight | 228.23 g/mol |
| IUPAC name | [ethenyl(phenyl)phosphoryl]benzene |
| InChIKey | CQCGPNRIAFVNBY-UHFFFAOYSA-N |
| SMILES | C=CP(=O)(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)