CAS 2096075-14-6 is the registry number for 4-Amino-1,3,7,7-tetramethyl-1,6,7,8-tetrahydro-5h-pyrazolo[3,4-b]quinolin-5-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-amino-1,3,7,7-tetramethyl-6,8-dihydropyrazolo[3,4-b]quinolin-5-one (CAS 2096075-14-6) is a chemical compound with the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. IUPAC name: 4-amino-1,3,7,7-tetramethyl-6,8-dihydropyrazolo[3,4-b]quinolin-5-one. InChIKey: JUHAWOUKOIQRHQ-UHFFFAOYSA-N.
| Molecular formula | C14H18N4O |
|---|---|
| Molecular weight | 258.32 g/mol |
| IUPAC name | 4-amino-1,3,7,7-tetramethyl-6,8-dihydropyrazolo[3,4-b]quinolin-5-one |
| InChIKey | JUHAWOUKOIQRHQ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=NC3=C(C(=O)CC(C3)(C)C)C(=C12)N)C |
Computed by PubChem (NCBI)