Products 2096329-54-1

CAS 2096329-54-1 is the registry number for 6-Butoxy-2-fluoropyridine-3-boronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(6-butoxy-2-fluoro-3-pyridinyl)boronic acid (CAS 2096329-54-1) is a chemical compound with the molecular formula C9H13BFNO3 and a molecular weight of 213.02 g/mol. IUPAC name: (6-butoxy-2-fluoro-3-pyridinyl)boronic acid. InChIKey: ASQMUDBGOSFYAL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13BFNO3
Molecular weight213.02 g/mol
IUPAC name(6-butoxy-2-fluoro-3-pyridinyl)boronic acid
InChIKeyASQMUDBGOSFYAL-UHFFFAOYSA-N
SMILESB(C1=C(N=C(C=C1)OCCCC)F)(O)O

Computed by PubChem (NCBI)