CAS 2096329-61-0 is the registry number for 3-Bromofuran-2-boronic acid, monolithium salt, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 25g.
Lithium (3-bromofuran-2-yl)-hydroxyborinate (CAS 2096329-61-0) is a chemical compound with the molecular formula C4H3BBrLiO3 and a molecular weight of 196.7 g/mol. IUPAC name: lithium (3-bromofuran-2-yl)-hydroxyborinate. InChIKey: IDUSCGXOYPIJEV-UHFFFAOYSA-N.
| Molecular formula | C4H3BBrLiO3 |
|---|---|
| Molecular weight | 196.7 g/mol |
| IUPAC name | lithium (3-bromofuran-2-yl)-hydroxyborinate |
| InChIKey | IDUSCGXOYPIJEV-UHFFFAOYSA-N |
| SMILES | [Li+].B(C1=C(C=CO1)Br)(O)[O-] |
Computed by PubChem (NCBI)