CAS 2096329-65-4 is the registry number for 5-Bromo-2-(2-methoxyethoxy)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[5-bromo-2-(2-methoxyethoxy)phenyl]boronic acid (CAS 2096329-65-4) is a chemical compound with the molecular formula C9H12BBrO4 and a molecular weight of 274.91 g/mol. IUPAC name: [5-bromo-2-(2-methoxyethoxy)phenyl]boronic acid. InChIKey: XLJIYIMLTNUCLP-UHFFFAOYSA-N.
| Molecular formula | C9H12BBrO4 |
|---|---|
| Molecular weight | 274.91 g/mol |
| IUPAC name | [5-bromo-2-(2-methoxyethoxy)phenyl]boronic acid |
| InChIKey | XLJIYIMLTNUCLP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Br)OCCOC)(O)O |
Computed by PubChem (NCBI)