CAS 2096330-01-5 is the registry number for 4-(N-Cbz-N-Ethylamino)phenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Benzyl N-ethyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 2096330-01-5) is a chemical compound with the molecular formula C22H28BNO4 and a molecular weight of 381.3 g/mol. IUPAC name: benzyl N-ethyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: MVDJZPADPSIBMH-UHFFFAOYSA-N.
| Molecular formula | C22H28BNO4 |
|---|---|
| Molecular weight | 381.3 g/mol |
| IUPAC name | benzyl N-ethyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | MVDJZPADPSIBMH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N(CC)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)