CAS 2096330-12-8 appears in our catalog under these names: [2-Chloro-5-methoxy-4-(trifluoromethoxy)phenyl]boronic acid, 97%, (2-Chloro-5-methoxy-4-(trifluoromethoxy)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
[2-chloro-5-methoxy-4-(trifluoromethoxy)phenyl]boronic acid (CAS 2096330-12-8) is a chemical compound with the molecular formula C8H7BClF3O4 and a molecular weight of 270.40 g/mol. IUPAC name: [2-chloro-5-methoxy-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: NXEVTVKKAKXECU-UHFFFAOYSA-N.
| Molecular formula | C8H7BClF3O4 |
|---|---|
| Molecular weight | 270.40 g/mol |
| IUPAC name | [2-chloro-5-methoxy-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | NXEVTVKKAKXECU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)OC(F)(F)F)OC)(O)O |
Computed by PubChem (NCBI)