Products 2096330-80-0

CAS 2096330-80-0 appears in our catalog under these names: 2-Fluoro-3-methoxy-5-(trifluoromethoxy)phenylboronic acid, 98%, (2-Fluoro-3-methoxy-5-(trifluoromethoxy)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.

Structural formula: {0} (CAS {1})

[2-fluoro-3-methoxy-5-(trifluoromethoxy)phenyl]boronic acid (CAS 2096330-80-0) is a chemical compound with the molecular formula C8H7BF4O4 and a molecular weight of 253.95 g/mol. IUPAC name: [2-fluoro-3-methoxy-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: QTABOWWUARPZFF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BF4O4
Molecular weight253.95 g/mol
IUPAC name[2-fluoro-3-methoxy-5-(trifluoromethoxy)phenyl]boronic acid
InChIKeyQTABOWWUARPZFF-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1F)OC)OC(F)(F)F)(O)O

Computed by PubChem (NCBI)