CAS 2096331-03-0 is the registry number for 4-(Cyclopentyl)iminomethylphenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Cyclopentyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine (CAS 2096331-03-0) is a chemical compound with the molecular formula C18H26BNO2 and a molecular weight of 299.2 g/mol. IUPAC name: cyclopentyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine. InChIKey: UHXLOSSUOVPFMK-UHFFFAOYSA-N.
| Molecular formula | C18H26BNO2 |
|---|---|
| Molecular weight | 299.2 g/mol |
| IUPAC name | cyclopentyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
| InChIKey | UHXLOSSUOVPFMK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=N)C3CCCC3 |
Computed by PubChem (NCBI)