CAS 2096331-53-0 is the registry number for 5–(2–trifluoromethylphenyl)furan–2–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
[5-[2-(trifluoromethyl)phenyl]furan-2-yl]boronic acid (CAS 2096331-53-0) is a chemical compound with the molecular formula C11H8BF3O3 and a molecular weight of 255.99 g/mol. IUPAC name: [5-[2-(trifluoromethyl)phenyl]furan-2-yl]boronic acid. InChIKey: YJOLYZRKTXWYON-UHFFFAOYSA-N.
| Molecular formula | C11H8BF3O3 |
|---|---|
| Molecular weight | 255.99 g/mol |
| IUPAC name | [5-[2-(trifluoromethyl)phenyl]furan-2-yl]boronic acid |
| InChIKey | YJOLYZRKTXWYON-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(O1)C2=CC=CC=C2C(F)(F)F)(O)O |
Computed by PubChem (NCBI)