CAS 2096331-62-1 is the registry number for 4-(Cyclopropylamino)methyl-2-fluorophenylboronic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-[(cyclopropylamino)methyl]-2-fluorophenyl]boronic acid;hydrochloride (CAS 2096331-62-1) is a chemical compound with the molecular formula C10H14BClFNO2 and a molecular weight of 245.49 g/mol. IUPAC name: [4-[(cyclopropylamino)methyl]-2-fluorophenyl]boronic acid;hydrochloride. InChIKey: SFYJPFZWNWOVJS-UHFFFAOYSA-N.
| Molecular formula | C10H14BClFNO2 |
|---|---|
| Molecular weight | 245.49 g/mol |
| IUPAC name | [4-[(cyclopropylamino)methyl]-2-fluorophenyl]boronic acid;hydrochloride |
| InChIKey | SFYJPFZWNWOVJS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)CNC2CC2)F)(O)O.Cl |
Computed by PubChem (NCBI)