CAS 2096331-69-8 appears in our catalog under these names: 2-Chloro-5-propionylphenylboronic acid, 97%, (2-Chloro-5-propionylphenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 25g.
(2-chloro-5-propanoylphenyl)boronic acid (CAS 2096331-69-8) is a chemical compound with the molecular formula C9H10BClO3 and a molecular weight of 212.44 g/mol. IUPAC name: (2-chloro-5-propanoylphenyl)boronic acid. InChIKey: FFRIUDOPHSDOOP-UHFFFAOYSA-N.
| Molecular formula | C9H10BClO3 |
|---|---|
| Molecular weight | 212.44 g/mol |
| IUPAC name | (2-chloro-5-propanoylphenyl)boronic acid |
| InChIKey | FFRIUDOPHSDOOP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)CC)Cl)(O)O |
Computed by PubChem (NCBI)