CAS 2096331-71-2 is the registry number for 4-(N-(Furan-2-ylmethyl)sulfamoyl)-2-trifluoromethylphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-(furan-2-ylmethylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid (CAS 2096331-71-2) is a chemical compound with the molecular formula C12H11BF3NO5S and a molecular weight of 349.09 g/mol. IUPAC name: [4-(furan-2-ylmethylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: KCIXOJJWCXCTEV-UHFFFAOYSA-N.
| Molecular formula | C12H11BF3NO5S |
|---|---|
| Molecular weight | 349.09 g/mol |
| IUPAC name | [4-(furan-2-ylmethylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | KCIXOJJWCXCTEV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)S(=O)(=O)NCC2=CC=CO2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)