CAS 2096331-91-6 is the registry number for [3-(Benzyloxy)-2,4-difluoro-5-methylphenyl]boronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2,4-difluoro-5-methyl-3-phenylmethoxyphenyl)boronic acid (CAS 2096331-91-6) is a chemical compound with the molecular formula C14H13BF2O3 and a molecular weight of 278.06 g/mol. IUPAC name: (2,4-difluoro-5-methyl-3-phenylmethoxyphenyl)boronic acid. InChIKey: IVSFYAXLMLBYNW-UHFFFAOYSA-N.
| Molecular formula | C14H13BF2O3 |
|---|---|
| Molecular weight | 278.06 g/mol |
| IUPAC name | (2,4-difluoro-5-methyl-3-phenylmethoxyphenyl)boronic acid |
| InChIKey | IVSFYAXLMLBYNW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)OCC2=CC=CC=C2)F)C)(O)O |
Computed by PubChem (NCBI)