CAS 2096331-98-3 appears in our catalog under these names: 4-(1-Cyanocyclobutyl)-2-fluorophenylboronic acid, 97%, (4-(1-Cyanocyclobutyl)-2-fluorophenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[4-(1-cyanocyclobutyl)-2-fluorophenyl]boronic acid (CAS 2096331-98-3) is a chemical compound with the molecular formula C11H11BFNO2 and a molecular weight of 219.02 g/mol. IUPAC name: [4-(1-cyanocyclobutyl)-2-fluorophenyl]boronic acid. InChIKey: XPDWYYCENNLCPJ-UHFFFAOYSA-N.
| Molecular formula | C11H11BFNO2 |
|---|---|
| Molecular weight | 219.02 g/mol |
| IUPAC name | [4-(1-cyanocyclobutyl)-2-fluorophenyl]boronic acid |
| InChIKey | XPDWYYCENNLCPJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C2(CCC2)C#N)F)(O)O |
Computed by PubChem (NCBI)