CAS 2096332-00-0 is the registry number for 2-(t-Butylsulfamoyl)thiophene-3-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[2-(tert-butylsulfamoyl)thiophen-3-yl]boronic acid (CAS 2096332-00-0) is a chemical compound with the molecular formula C8H14BNO4S2 and a molecular weight of 263.1 g/mol. IUPAC name: [2-(tert-butylsulfamoyl)thiophen-3-yl]boronic acid. InChIKey: KKWWEEGTWUESCU-UHFFFAOYSA-N.
| Molecular formula | C8H14BNO4S2 |
|---|---|
| Molecular weight | 263.1 g/mol |
| IUPAC name | [2-(tert-butylsulfamoyl)thiophen-3-yl]boronic acid |
| InChIKey | KKWWEEGTWUESCU-UHFFFAOYSA-N |
| SMILES | B(C1=C(SC=C1)S(=O)(=O)NC(C)(C)C)(O)O |
Computed by PubChem (NCBI)