CAS 2096332-07-7 is the registry number for 3-Chlorothiophene-2,5-diboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(5-borono-3-chlorothiophen-2-yl)boronic acid (CAS 2096332-07-7) is a chemical compound with the molecular formula C4H5B2ClO4S and a molecular weight of 206.2 g/mol. IUPAC name: (5-borono-3-chlorothiophen-2-yl)boronic acid. InChIKey: HWPJMSMTYFBAGQ-UHFFFAOYSA-N.
| Molecular formula | C4H5B2ClO4S |
|---|---|
| Molecular weight | 206.2 g/mol |
| IUPAC name | (5-borono-3-chlorothiophen-2-yl)boronic acid |
| InChIKey | HWPJMSMTYFBAGQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(S1)B(O)O)Cl)(O)O |
Computed by PubChem (NCBI)