Products 2096333-35-4

CAS 2096333-35-4 is the registry number for 3-Bromo-5-t-butyl-2-fluorophenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(3-bromo-5-tert-butyl-2-fluorophenyl)boronic acid (CAS 2096333-35-4) is a chemical compound with the molecular formula C10H13BBrFO2 and a molecular weight of 274.92 g/mol. IUPAC name: (3-bromo-5-tert-butyl-2-fluorophenyl)boronic acid. InChIKey: KFIDBWNQEIABRB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13BBrFO2
Molecular weight274.92 g/mol
IUPAC name(3-bromo-5-tert-butyl-2-fluorophenyl)boronic acid
InChIKeyKFIDBWNQEIABRB-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1F)Br)C(C)(C)C)(O)O

Computed by PubChem (NCBI)