Products 2096333-74-1
CAS 2096333-74-1 is the registry number for (4-(2-(Piperidin-1-yl)thiazol-4-yl)phenyl)boronic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
[4-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenyl]boronic acid (CAS 2096333-74-1) is a chemical compound with the molecular formula C14H17BN2O2S and a molecular weight of 288.2 g/mol. IUPAC name: [4-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenyl]boronic acid. InChIKey: COIPGBLOSPNZJC-UHFFFAOYSA-N.
| Molecular formula | C14H17BN2O2S |
|---|---|
| Molecular weight | 288.2 g/mol |
| IUPAC name | [4-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenyl]boronic acid |
| InChIKey | COIPGBLOSPNZJC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CSC(=N2)N3CCCCC3)(O)O |
Computed by PubChem (NCBI)